C19H19N7O4 — CID 162701278
2-amino-N-[3-ethyl-7-(2-isocyanoethoxy)-8-methoxy-4-oxoquinazolin-2-yl]pyrimidine-5-carboxamide (PubChem CID 162701278) has the molecular formula C19H19N7O4 and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-amino-N-[3-ethyl-7-(2-isocyanoethoxy)-8-methoxy-4-oxoquinazolin-2-yl]pyrimidine-5-carboxamide.
| Compound Name | 2-amino-N-[3-ethyl-7-(2-isocyanoethoxy)-8-methoxy-4-oxoquinazolin-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162701278 |
| Molecular Formula | C19H19N7O4 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-amino-N-[3-ethyl-7-(2-isocyanoethoxy)-8-methoxy-4-oxoquinazolin-2-yl]pyrimidine-5-carboxamide |
| SMILES | [C-]#[N+]CCOc1ccc2c(=O)n(CC)c(NC(=O)c3cnc(N)nc3)nc2c1OC |
| InChI | InChI=1S/C19H19N7O4/c1-4-26-17(28)12-5-6-13(30-8-7-21-2)15(29-3)14(12)24-19(26)25-16(27)11-9-22-18(20)23-10-11/h5-6,9-10H,4,7-8H2,1,3H3,(H2,20,22,23)(H,24,25,27) |
| InChIKey | BSCDOSIBOYJPJL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 138.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|