C54H41N3Si — CID 162701563
[3-[4-(3-carbazol-9-ylphenyl)-6-(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-triphenylsilane (PubChem CID 162701563) has the molecular formula C54H41N3Si and a molecular weight of 760.03 g/mol. Its IUPAC name is [3-[4-(3-carbazol-9-ylphenyl)-6-(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-triphenylsilane.
| Compound Name | [3-[4-(3-carbazol-9-ylphenyl)-6-(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-triphenylsilane |
|---|---|
| PubChem CID | 162701563 |
| Molecular Formula | C54H41N3Si |
| Molecular Weight | 760.03 g/mol |
| Exact Mass | 759.31 |
| IUPAC Name | [3-[4-(3-carbazol-9-ylphenyl)-6-(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-triphenylsilane |
| SMILES | Cc1cc(C)cc(-c2cc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)nc(-c3cccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)c3)n2)c1 |
| InChI | InChI=1S/C54H41N3Si/c1-38-32-39(2)34-42(33-38)51-37-50(40-18-16-20-43(35-40)57-52-30-14-12-28-48(52)49-29-13-15-31-53(49)57)55-54(56-51)41-19-17-27-47(36-41)58(44-21-6-3-7-22-44,45-23-8-4-9-24-45)46-25-10-5-11-26-46/h3-37H,1-2H3 |
| InChIKey | XGZNJIIWMPPYTB-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.03 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|