C19H28O4 — CID 162702094
2-[(3E,5E,7S)-5,7-dimethyl-2-oxonona-3,5-dienyl]-4,6-dihydroxy-5-methylcyclohexene-1-carbaldehyde (PubChem CID 162702094) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-[(3E,5E,7S)-5,7-dimethyl-2-oxonona-3,5-dienyl]-4,6-dihydroxy-5-methylcyclohexene-1-carbaldehyde.
| Compound Name | 2-[(3E,5E,7S)-5,7-dimethyl-2-oxonona-3,5-dienyl]-4,6-dihydroxy-5-methylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 162702094 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[(3E,5E,7S)-5,7-dimethyl-2-oxonona-3,5-dienyl]-4,6-dihydroxy-5-methylcyclohexene-1-carbaldehyde |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C(=O)CC1=C(C=O)C(O)C(C)C(O)C1 |
| InChI | InChI=1S/C19H28O4/c1-5-12(2)8-13(3)6-7-16(21)9-15-10-18(22)14(4)19(23)17(15)11-20/h6-8,11-12,14,18-19,22-23H,5,9-10H2,1-4H3/b7-6+,13-8+/t12-,14?,18?,19?/m0/s1 |
| InChIKey | DEMKVZWZHPSECV-HQHGKODGSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|