C9H11N7 — CID 162702986
1-(2-azidoethyl)-2-(1-methylimidazol-2-yl)imidazole (PubChem CID 162702986) has the molecular formula C9H11N7 and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-(2-azidoethyl)-2-(1-methylimidazol-2-yl)imidazole.
| Compound Name | 1-(2-azidoethyl)-2-(1-methylimidazol-2-yl)imidazole |
|---|---|
| PubChem CID | 162702986 |
| Molecular Formula | C9H11N7 |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(2-azidoethyl)-2-(1-methylimidazol-2-yl)imidazole |
| SMILES | Cn1ccnc1-c1nccn1CCN=[N+]=[N-] |
| InChI | InChI=1S/C9H11N7/c1-15-5-2-11-8(15)9-12-3-6-16(9)7-4-13-14-10/h2-3,5-6H,4,7H2,1H3 |
| InChIKey | MAYLBBJIVKYTME-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|