C33H33F5N2O10 — CID 162704061
3-[3-[[carboxymethyl-[2-[carboxymethyl-[[2-hydroxy-5-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butyl]phenyl]methyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid (PubChem CID 162704061) has the molecular formula C33H33F5N2O10 and a molecular weight of 712.62 g/mol. Its IUPAC name is 3-[3-[[carboxymethyl-[2-[carboxymethyl-[[2-hydroxy-5-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butyl]phenyl]methyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid.
| Compound Name | 3-[3-[[carboxymethyl-[2-[carboxymethyl-[[2-hydroxy-5-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butyl]phenyl]methyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 162704061 |
| Molecular Formula | C33H33F5N2O10 |
| Molecular Weight | 712.62 g/mol |
| Exact Mass | 712.21 |
| IUPAC Name | 3-[3-[[carboxymethyl-[2-[carboxymethyl-[[2-hydroxy-5-[4-oxo-4-(2,3,4,5,6-pentafluorophenoxy)butyl]phenyl]methyl]amino]ethyl]amino]methyl]-4-hydroxyphenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCCC(=O)Oc3c(F)c(F)c(F)c(F)c3F)ccc2O)CC(=O)O)c1 |
| InChI | InChI=1S/C33H33F5N2O10/c34-28-29(35)31(37)33(32(38)30(28)36)50-27(49)3-1-2-18-4-7-22(41)20(12-18)14-39(16-25(45)46)10-11-40(17-26(47)48)15-21-13-19(5-8-23(21)42)6-9-24(43)44/h4-5,7-8,12-13,41-42H,1-3,6,9-11,14-17H2,(H,43,44)(H,45,46)(H,47,48) |
| InChIKey | YDXWVKDMDAXPIN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|