C41H42FN5O7 — CID 162704211
(2R)-N-[4-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704211) has the molecular formula C41H42FN5O7 and a molecular weight of 735.81 g/mol. Its IUPAC name is (2R)-N-[4-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704211 |
| Molecular Formula | C41H42FN5O7 |
| Molecular Weight | 735.81 g/mol |
| Exact Mass | 735.31 |
| IUPAC Name | (2R)-N-[4-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCOCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C41H42FN5O7/c1-24(25-5-7-26(8-6-25)30-17-18-43-33-14-9-27(42)23-32(30)33)38(49)45-28-10-12-29(13-11-28)54-22-21-53-20-19-44-34-4-2-3-31-37(34)41(52)47(40(31)51)35-15-16-36(48)46-39(35)50/h2-4,9-14,17-18,23-26,35,44H,5-8,15-16,19-22H2,1H3,(H,45,49)(H,46,48,50)/t24-,25?,26?,35?/m1/s1 |
| InChIKey | BRNOYXPKQRSICJ-DAVQAOOQSA-N |
| XLogP | 5.83 |
| TPSA | 156.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.81 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|