C41H41FN4O8 — CID 162704222
(2R)-N-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704222) has the molecular formula C41H41FN4O8 and a molecular weight of 736.80 g/mol. Its IUPAC name is (2R)-N-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704222 |
| Molecular Formula | C41H41FN4O8 |
| Molecular Weight | 736.80 g/mol |
| Exact Mass | 736.29 |
| IUPAC Name | (2R)-N-[4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCOCCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C41H41FN4O8/c1-24(25-5-7-26(8-6-25)30-17-18-43-33-14-9-27(42)23-32(30)33)38(48)44-28-10-12-29(13-11-28)53-21-19-52-20-22-54-35-4-2-3-31-37(35)41(51)46(40(31)50)34-15-16-36(47)45-39(34)49/h2-4,9-14,17-18,23-26,34H,5-8,15-16,19-22H2,1H3,(H,44,48)(H,45,47,49)/t24-,25?,26?,34?/m1/s1 |
| InChIKey | JKRRANUUGZKPLV-NDPDVRSMSA-N |
| XLogP | 5.80 |
| TPSA | 153.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.80 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|