C41H42FN5O6 — CID 162704234
(2R)-N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704234) has the molecular formula C41H42FN5O6 and a molecular weight of 719.81 g/mol. Its IUPAC name is (2R)-N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704234 |
| Molecular Formula | C41H42FN5O6 |
| Molecular Weight | 719.81 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | (2R)-N-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]butoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C41H42FN5O6/c1-24(25-7-9-26(10-8-25)30-19-21-44-33-16-11-27(42)23-32(30)33)38(49)45-28-12-14-29(15-13-28)53-22-3-2-20-43-34-6-4-5-31-37(34)41(52)47(40(31)51)35-17-18-36(48)46-39(35)50/h4-6,11-16,19,21,23-26,35,43H,2-3,7-10,17-18,20,22H2,1H3,(H,45,49)(H,46,48,50)/t24-,25?,26?,35?/m1/s1 |
| InChIKey | BDYXVTZBZCAMNL-DAVQAOOQSA-N |
| XLogP | 6.59 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.81 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|