C41H41FN4O7 — CID 162704242
(2R)-N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704242) has the molecular formula C41H41FN4O7 and a molecular weight of 720.80 g/mol. Its IUPAC name is (2R)-N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704242 |
| Molecular Formula | C41H41FN4O7 |
| Molecular Weight | 720.80 g/mol |
| Exact Mass | 720.30 |
| IUPAC Name | (2R)-N-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxybutoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCCCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C41H41FN4O7/c1-24(25-7-9-26(10-8-25)30-19-20-43-33-16-11-27(42)23-32(30)33)38(48)44-28-12-14-29(15-13-28)52-21-2-3-22-53-35-6-4-5-31-37(35)41(51)46(40(31)50)34-17-18-36(47)45-39(34)49/h4-6,11-16,19-20,23-26,34H,2-3,7-10,17-18,21-22H2,1H3,(H,44,48)(H,45,47,49)/t24-,25?,26?,34?/m1/s1 |
| InChIKey | WCUAWRUQBMUSHV-NDPDVRSMSA-N |
| XLogP | 6.56 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.80 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|