C43H45FN4O9 — CID 162704247
(2R)-N-[4-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide (PubChem CID 162704247) has the molecular formula C43H45FN4O9 and a molecular weight of 780.85 g/mol. Its IUPAC name is (2R)-N-[4-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide.
| Compound Name | (2R)-N-[4-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 162704247 |
| Molecular Formula | C43H45FN4O9 |
| Molecular Weight | 780.85 g/mol |
| Exact Mass | 780.32 |
| IUPAC Name | (2R)-N-[4-[2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethoxy]ethoxy]ethoxy]phenyl]-2-[4-(6-fluoroquinolin-4-yl)cyclohexyl]propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(OCCOCCOCCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1)C1CCC(c2ccnc3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C43H45FN4O9/c1-26(27-5-7-28(8-6-27)32-17-18-45-35-14-9-29(44)25-34(32)35)40(50)46-30-10-12-31(13-11-30)56-23-21-54-19-20-55-22-24-57-37-4-2-3-33-39(37)43(53)48(42(33)52)36-15-16-38(49)47-41(36)51/h2-4,9-14,17-18,25-28,36H,5-8,15-16,19-24H2,1H3,(H,46,50)(H,47,49,51)/t26-,27?,28?,36?/m1/s1 |
| InChIKey | PNKAQPREROSSJA-VIXSKNLFSA-N |
| XLogP | 5.81 |
| TPSA | 162.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.85 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|