C14H18N2O6 — CID 162704942
(6-deuterio-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate (PubChem CID 162704942) has the molecular formula C14H18N2O6 and a molecular weight of 311.31 g/mol. Its IUPAC name is (6-deuterio-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate.
| Compound Name | (6-deuterio-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 162704942 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (6-deuterio-2-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl) 4-(methylamino)-4-oxobutanoate |
| SMILES | [2H]C1C(OC(=O)CCC(=O)NC)C2OC1C1C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C14H18N2O6/c1-15-8(17)3-4-9(18)21-7-5-6-10-11(12(7)22-6)14(20)16(2)13(10)19/h6-7,10-12H,3-5H2,1-2H3,(H,15,17)/i5D |
| InChIKey | IQTFYIDCQBUTGL-UICOGKGYSA-N |
| XLogP | -1.17 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|