C30H46N2 — CID 162706102
(1S)-3-tert-butyl-5,5-dicyclohexyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole (PubChem CID 162706102) has the molecular formula C30H46N2 and a molecular weight of 434.71 g/mol. Its IUPAC name is (1S)-3-tert-butyl-5,5-dicyclohexyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole.
| Compound Name | (1S)-3-tert-butyl-5,5-dicyclohexyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 162706102 |
| Molecular Formula | C30H46N2 |
| Molecular Weight | 434.71 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | (1S)-3-tert-butyl-5,5-dicyclohexyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
| SMILES | Cc1ccccc1N1C(C(C)(C)C)N2C(C=CC2(C2CCCCC2)C2CCCCC2)[C@@H]1C |
| InChI | InChI=1S/C30H46N2/c1-22-14-12-13-19-26(22)31-23(2)27-20-21-30(24-15-8-6-9-16-24,25-17-10-7-11-18-25)32(27)28(31)29(3,4)5/h12-14,19-21,23-25,27-28H,6-11,15-18H2,1-5H3/t23-,27?,28?/m0/s1 |
| InChIKey | KRJIPSQZZVUPKV-GHXQVECXSA-N |
| XLogP | 7.72 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.71 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|