About (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine
(4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine (PubChem CID 162706210) has the molecular formula C13H20N2
and a molecular weight of 205.32 g/mol. Its IUPAC name is (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine.
Molecular Properties
| Compound Name | (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine |
| PubChem CID | 162706210 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine |
| SMILES | [2H]C1N(C)C(C)[C@H](C)N1c1ccccc1C |
| InChI | InChI=1S/C13H20N2/c1-10-7-5-6-8-13(10)15-9-14(4)11(2)12(15)3/h5-8,11-12H,9H2,1-4H3/t11?,12-/m0/s1/i9D/t9?,11?,12- |
| InChIKey | MMYAKQPNLUMWDQ-OLOSXHJLSA-N |
| XLogP | 2.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine?
The IUPAC name of (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine (CID 162706210) is (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine.
What is the SMILES notation for (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine?
The canonical SMILES for (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine is [2H]C1N(C)C(C)[C@H](C)N1c1ccccc1C.
What is the InChIKey of (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine?
The InChIKey is MMYAKQPNLUMWDQ-OLOSXHJLSA-N. The full InChI is InChI=1S/C13H20N2/c1-10-7-5-6-8-13(10)15-9-14(4)11(2)12(15)3/h5-8,11-12H,9H2,1-4H3/t11?,12-/m0/s1/i9D/t9?,11?,12-.
What are the key properties of (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine?
(4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine has a molecular weight of 205.32 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-deuterio-1,4,5-trimethyl-3-(2-methylphenyl)imidazolidine is sourced from PubChem (CID 162706210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).