C30H44N2 — CID 162706264
(1S)-5-cyclohexyl-3,5-dicyclopentyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole (PubChem CID 162706264) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is (1S)-5-cyclohexyl-3,5-dicyclopentyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole.
| Compound Name | (1S)-5-cyclohexyl-3,5-dicyclopentyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 162706264 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | (1S)-5-cyclohexyl-3,5-dicyclopentyl-1-methyl-2-(2-methylphenyl)-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
| SMILES | Cc1ccccc1N1C(C2CCCC2)N2C(C=CC2(C2CCCCC2)C2CCCC2)[C@@H]1C |
| InChI | InChI=1S/C30H44N2/c1-22-12-6-11-19-27(22)31-23(2)28-20-21-30(26-17-9-10-18-26,25-15-4-3-5-16-25)32(28)29(31)24-13-7-8-14-24/h6,11-12,19-21,23-26,28-29H,3-5,7-10,13-18H2,1-2H3/t23-,28?,29?,30?/m0/s1 |
| InChIKey | OHHZHNJMIGLCPO-WJRIUKBOSA-N |
| XLogP | 7.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|