About (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine
(5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine (PubChem CID 162706558) has the molecular formula C23H30N2
and a molecular weight of 334.51 g/mol. Its IUPAC name is (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine.
Molecular Properties
| Compound Name | (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine |
| PubChem CID | 162706558 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine |
| SMILES | Cc1ccccc1N1C(C)N(c2ccccc2)C(C2CCCC2)[C@@H]1C |
| InChI | InChI=1S/C23H30N2/c1-17-11-7-10-16-22(17)24-18(2)23(20-12-8-9-13-20)25(19(24)3)21-14-5-4-6-15-21/h4-7,10-11,14-16,18-20,23H,8-9,12-13H2,1-3H3/t18-,19?,23?/m0/s1 |
| InChIKey | IHBFLABQOKGHEG-HGCBZUSOSA-N |
| XLogP | 5.61 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine?
The IUPAC name of (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine (CID 162706558) is (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine.
What is the SMILES notation for (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine?
The canonical SMILES for (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine is Cc1ccccc1N1C(C)N(c2ccccc2)C(C2CCCC2)[C@@H]1C.
What is the InChIKey of (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine?
The InChIKey is IHBFLABQOKGHEG-HGCBZUSOSA-N. The full InChI is InChI=1S/C23H30N2/c1-17-11-7-10-16-22(17)24-18(2)23(20-12-8-9-13-20)25(19(24)3)21-14-5-4-6-15-21/h4-7,10-11,14-16,18-20,23H,8-9,12-13H2,1-3H3/t18-,19?,23?/m0/s1.
What are the key properties of (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine?
(5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine has a molecular weight of 334.51 g/mol, XLogP of 5.61, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-4-cyclopentyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazolidine is sourced from PubChem (CID 162706558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).