C38H32IrN2-2 — CID 162708126
3-benzyl-2-phenylpyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)-4-propan-2-ylpyridine (PubChem CID 162708126) has the molecular formula C38H32IrN2-2 and a molecular weight of 708.91 g/mol. Its IUPAC name is 3-benzyl-2-phenylpyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)-4-propan-2-ylpyridine.
| Compound Name | 3-benzyl-2-phenylpyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 162708126 |
| Molecular Formula | C38H32IrN2-2 |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 709.22 |
| IUPAC Name | 3-benzyl-2-phenylpyridine;iridium;2-(3-phenylbenzene-6-id-1-yl)-4-propan-2-ylpyridine |
| SMILES | CC(C)c1ccnc(-c2[c-]ccc(-c3ccccc3)c2)c1.[Ir].[c-]1ccccc1-c1ncccc1Cc1ccccc1 |
| InChI | InChI=1S/C20H18N.C18H14N.Ir/c1-15(2)17-11-12-21-20(14-17)19-10-6-9-18(13-19)16-7-4-3-5-8-16;1-3-8-15(9-4-1)14-17-12-7-13-19-18(17)16-10-5-2-6-11-16;/h3-9,11-15H,1-2H3;1-10,12-13H,14H2;/q2*-1; |
| InChIKey | HRVMKJFUIIJFHM-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|