C39H35FIrN2Si-2 — CID 162708437
2-[3-[dideuterio(phenyl)methyl]-4-fluorobenzene-6-id-1-yl]pyridine;iridium;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane (PubChem CID 162708437) has the molecular formula C39H35FIrN2Si-2 and a molecular weight of 776.05 g/mol. Its IUPAC name is 2-[3-[dideuterio(phenyl)methyl]-4-fluorobenzene-6-id-1-yl]pyridine;iridium;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane.
| Compound Name | 2-[3-[dideuterio(phenyl)methyl]-4-fluorobenzene-6-id-1-yl]pyridine;iridium;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
|---|---|
| PubChem CID | 162708437 |
| Molecular Formula | C39H35FIrN2Si-2 |
| Molecular Weight | 776.05 g/mol |
| Exact Mass | 776.25 |
| IUPAC Name | 2-[3-[dideuterio(phenyl)methyl]-4-fluorobenzene-6-id-1-yl]pyridine;iridium;trimethyl-[4-phenyl-6-[4-(trideuteriomethyl)benzene-6-id-1-yl]-3-pyridinyl]silane |
| SMILES | [2H]C([2H])([2H])c1c[c-]c(-c2cc(-c3ccccc3)c([Si](C)(C)C)cn2)cc1.[2H]C([2H])(c1ccccc1)c1cc(-c2ccccn2)[c-]cc1F.[Ir] |
| InChI | InChI=1S/C21H22NSi.C18H13FN.Ir/c1-16-10-12-18(13-11-16)20-14-19(17-8-6-5-7-9-17)21(15-22-20)23(2,3)4;19-17-10-9-15(18-8-4-5-11-20-18)13-16(17)12-14-6-2-1-3-7-14;/h5-12,14-15H,1-4H3;1-8,10-11,13H,12H2;/q2*-1;/i1D3;12D2; |
| InChIKey | QWHYWOOBKFSPTR-ZXSIPHIYSA-N |
| XLogP | 9.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.05 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|