About 4-methyl-3-nitrophenol
4-methyl-3-nitrophenol (PubChem CID 16271) has the molecular formula C7H7NO3
and a molecular weight of 153.14 g/mol. Its IUPAC name is 4-methyl-3-nitrophenol.
Molecular Properties
| Compound Name | 4-methyl-3-nitrophenol |
| PubChem CID | 16271 |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | 4-methyl-3-nitrophenol |
| SMILES | Cc1ccc(O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3 |
| InChIKey | BQEXDUKMTVYBRK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-nitrophenol?
The IUPAC name of 4-methyl-3-nitrophenol (CID 16271) is 4-methyl-3-nitrophenol.
What is the SMILES notation for 4-methyl-3-nitrophenol?
The canonical SMILES for 4-methyl-3-nitrophenol is Cc1ccc(O)cc1[N+](=O)[O-].
What is the InChIKey of 4-methyl-3-nitrophenol?
The InChIKey is BQEXDUKMTVYBRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4,9H,1H3.
What are the key properties of 4-methyl-3-nitrophenol?
4-methyl-3-nitrophenol has a molecular weight of 153.14 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-nitrophenol is sourced from PubChem (CID 16271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).