C31H42Cl2N2O2 — CID 162711328
[(1R)-4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-2,2-dimethyl-1-(trideuteriomethyl)piperazin-1-ium-1-yl]methyl 2-cyclohexylacetate chloride (PubChem CID 162711328) has the molecular formula C31H42Cl2N2O2 and a molecular weight of 553.64 g/mol. Its IUPAC name is [(1R)-4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-2,2-dimethyl-1-(trideuteriomethyl)piperazin-1-ium-1-yl]methyl 2-cyclohexylacetate chloride.
| Compound Name | [(1R)-4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-2,2-dimethyl-1-(trideuteriomethyl)piperazin-1-ium-1-yl]methyl 2-cyclohexylacetate chloride |
|---|---|
| PubChem CID | 162711328 |
| Molecular Formula | C31H42Cl2N2O2 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | [(1R)-4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-2,2-dimethyl-1-(trideuteriomethyl)piperazin-1-ium-1-yl]methyl 2-cyclohexylacetate chloride |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H]2C[C@@H](N3CC[N@+](COC(=O)CC4CCCCC4)(C([2H])([2H])[2H])C(C)(C)C3)c3cc(Cl)ccc32)c([2H])c1[2H].[Cl-] |
| InChI | InChI=1S/C31H42ClN2O2.ClH/c1-31(2)21-33(16-17-34(31,3)22-36-30(35)18-23-10-6-4-7-11-23)29-20-27(24-12-8-5-9-13-24)26-15-14-25(32)19-28(26)29;/h5,8-9,12-15,19,23,27,29H,4,6-7,10-11,16-18,20-22H2,1-3H3;1H/q+1;/p-1/t27-,29+,34-;/m0./s1/i3D3,5D,8D,9D,12D,13D; |
| InChIKey | QZDNEHVAVUIWBW-DAZZQODQSA-M |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|