C23H19Cl3O3 — CID 162711731
[2-(6-hydroxy-2,3-dimethylphenyl)-3,4-dimethylphenyl] 2,4,6-trichlorobenzoate (PubChem CID 162711731) has the molecular formula C23H19Cl3O3 and a molecular weight of 449.76 g/mol. Its IUPAC name is [2-(6-hydroxy-2,3-dimethylphenyl)-3,4-dimethylphenyl] 2,4,6-trichlorobenzoate.
| Compound Name | [2-(6-hydroxy-2,3-dimethylphenyl)-3,4-dimethylphenyl] 2,4,6-trichlorobenzoate |
|---|---|
| PubChem CID | 162711731 |
| Molecular Formula | C23H19Cl3O3 |
| Molecular Weight | 449.76 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | [2-(6-hydroxy-2,3-dimethylphenyl)-3,4-dimethylphenyl] 2,4,6-trichlorobenzoate |
| SMILES | Cc1ccc(O)c(-c2c(OC(=O)c3c(Cl)cc(Cl)cc3Cl)ccc(C)c2C)c1C |
| InChI | InChI=1S/C23H19Cl3O3/c1-11-5-7-18(27)20(13(11)3)21-14(4)12(2)6-8-19(21)29-23(28)22-16(25)9-15(24)10-17(22)26/h5-10,27H,1-4H3 |
| InChIKey | MTOPEXSKQSJKNL-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.76 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|