C65H44N4 — CID 162712338
3-N,9-N-bis(2-isocyanophenyl)-11,11-dimethyl-3-N,9-N-bis(4-naphthalen-2-ylphenyl)benzo[a]fluorene-3,9-diamine (PubChem CID 162712338) has the molecular formula C65H44N4 and a molecular weight of 881.10 g/mol. Its IUPAC name is 3-N,9-N-bis(2-isocyanophenyl)-11,11-dimethyl-3-N,9-N-bis(4-naphthalen-2-ylphenyl)benzo[a]fluorene-3,9-diamine.
| Compound Name | 3-N,9-N-bis(2-isocyanophenyl)-11,11-dimethyl-3-N,9-N-bis(4-naphthalen-2-ylphenyl)benzo[a]fluorene-3,9-diamine |
|---|---|
| PubChem CID | 162712338 |
| Molecular Formula | C65H44N4 |
| Molecular Weight | 881.10 g/mol |
| Exact Mass | 880.36 |
| IUPAC Name | 3-N,9-N-bis(2-isocyanophenyl)-11,11-dimethyl-3-N,9-N-bis(4-naphthalen-2-ylphenyl)benzo[a]fluorene-3,9-diamine |
| SMILES | [C-]#[N+]c1ccccc1N(c1ccc(-c2ccc3ccccc3c2)cc1)c1ccc2c(c1)C(C)(C)c1c-2ccc2cc(N(c3ccc(-c4ccc5ccccc5c4)cc3)c3ccccc3[N+]#[C-])ccc12 |
| InChI | InChI=1S/C65H44N4/c1-65(2)59-42-55(69(63-20-12-10-18-61(63)67-4)53-32-27-46(28-33-53)50-24-22-44-14-6-8-16-48(44)40-50)35-38-57(59)58-36-29-51-41-54(34-37-56(51)64(58)65)68(62-19-11-9-17-60(62)66-3)52-30-25-45(26-31-52)49-23-21-43-13-5-7-15-47(43)39-49/h5-42H,1-2H3 |
| InChIKey | BYTWBENEVREYOT-UHFFFAOYSA-N |
| XLogP | 18.83 |
| TPSA | 15.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.10 |
| LogP ≤ 5 | 18.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|