C32H37N5O4Si — CID 162712860
N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyrimidin-2-yl]cyclopropanecarboxamide (PubChem CID 162712860) has the molecular formula C32H37N5O4Si and a molecular weight of 583.77 g/mol. Its IUPAC name is N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyrimidin-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyrimidin-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 162712860 |
| Molecular Formula | C32H37N5O4Si |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyrimidin-2-yl]cyclopropanecarboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccccc2)nc1C1COc2ccc(Oc3ccnc(NC(=O)C4CC4)n3)cc2C1 |
| InChI | InChI=1S/C32H37N5O4Si/c1-42(2,3)16-15-39-21-37-19-27(22-7-5-4-6-8-22)34-30(37)25-17-24-18-26(11-12-28(24)40-20-25)41-29-13-14-33-32(35-29)36-31(38)23-9-10-23/h4-8,11-14,18-19,23,25H,9-10,15-17,20-21H2,1-3H3,(H,33,35,36,38) |
| InChIKey | OSHVQQXVHVSYED-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|