C31H38N6O4Si — CID 162712877
5-[[3-[4-(2,5-dimethylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 162712877) has the molecular formula C31H38N6O4Si and a molecular weight of 586.77 g/mol. Its IUPAC name is 5-[[3-[4-(2,5-dimethylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 5-[[3-[4-(2,5-dimethylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 162712877 |
| Molecular Formula | C31H38N6O4Si |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | 5-[[3-[4-(2,5-dimethylpyrazol-3-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | Cc1cc(-c2cn(COCC[Si](C)(C)C)c(C3COc4ccc(Oc5ccnc6c5CCC(=O)N6)cc4C3)n2)n(C)n1 |
| InChI | InChI=1S/C31H38N6O4Si/c1-20-14-26(36(2)35-20)25-17-37(19-39-12-13-42(3,4)5)31(33-25)22-15-21-16-23(6-8-27(21)40-18-22)41-28-10-11-32-30-24(28)7-9-29(38)34-30/h6,8,10-11,14,16-17,22H,7,9,12-13,15,18-19H2,1-5H3,(H,32,34,38) |
| InChIKey | VMRRILSGFQUIIK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|