C33H36F2N4O4Si — CID 162712903
2,2-difluoro-N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-2-pyridinyl]cyclopropane-1-carboxamide (PubChem CID 162712903) has the molecular formula C33H36F2N4O4Si and a molecular weight of 618.76 g/mol. Its IUPAC name is 2,2-difluoro-N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-2-pyridinyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-difluoro-N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-2-pyridinyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 162712903 |
| Molecular Formula | C33H36F2N4O4Si |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | 2,2-difluoro-N-[4-[[3-[4-phenyl-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-3,4-dihydro-2H-chromen-6-yl]oxy]-2-pyridinyl]cyclopropane-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2ccccc2)nc1C1COc2ccc(Oc3ccnc(NC(=O)C4CC4(F)F)c3)cc2C1 |
| InChI | InChI=1S/C33H36F2N4O4Si/c1-44(2,3)14-13-41-21-39-19-28(22-7-5-4-6-8-22)37-31(39)24-15-23-16-25(9-10-29(23)42-20-24)43-26-11-12-36-30(17-26)38-32(40)27-18-33(27,34)35/h4-12,16-17,19,24,27H,13-15,18,20-21H2,1-3H3,(H,36,38,40) |
| InChIKey | PLRYZVAHWSAXHW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|