About bis(8-methanidyloxyoct-1-yne);rutherfordium
bis(8-methanidyloxyoct-1-yne);rutherfordium (PubChem CID 162713137) has the molecular formula C18H30O2Rf-2
and a molecular weight of 545.44 g/mol. Its IUPAC name is bis(8-methanidyloxyoct-1-yne);rutherfordium.
Molecular Properties
| Compound Name | bis(8-methanidyloxyoct-1-yne);rutherfordium |
| PubChem CID | 162713137 |
| Molecular Formula | C18H30O2Rf-2 |
| Molecular Weight | 545.44 g/mol |
| Exact Mass | 545.35 |
| IUPAC Name | bis(8-methanidyloxyoct-1-yne);rutherfordium |
| SMILES | C#CCCCCCCO[CH2-].C#CCCCCCCO[CH2-].[Rf] |
| InChI | InChI=1S/2C9H15O.Rf/c2*1-3-4-5-6-7-8-9-10-2;/h2*1H,2,4-9H2;/q2*-1; |
| InChIKey | SNAXTCYHZQRNFZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(8-methanidyloxyoct-1-yne);rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-methanidyloxyoct-1-yne);rutherfordium?
The IUPAC name of bis(8-methanidyloxyoct-1-yne);rutherfordium (CID 162713137) is bis(8-methanidyloxyoct-1-yne);rutherfordium.
What is the SMILES notation for bis(8-methanidyloxyoct-1-yne);rutherfordium?
The canonical SMILES for bis(8-methanidyloxyoct-1-yne);rutherfordium is C#CCCCCCCO[CH2-].C#CCCCCCCO[CH2-].[Rf].
What is the InChIKey of bis(8-methanidyloxyoct-1-yne);rutherfordium?
The InChIKey is SNAXTCYHZQRNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H15O.Rf/c2*1-3-4-5-6-7-8-9-10-2;/h2*1H,2,4-9H2;/q2*-1;.
What are the key properties of bis(8-methanidyloxyoct-1-yne);rutherfordium?
bis(8-methanidyloxyoct-1-yne);rutherfordium has a molecular weight of 545.44 g/mol, XLogP of 4.76, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-methanidyloxyoct-1-yne);rutherfordium is sourced from PubChem (CID 162713137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).