About 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene
8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene (PubChem CID 162715137) has the molecular formula C14H28S2
and a molecular weight of 260.51 g/mol. Its IUPAC name is 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene.
Molecular Properties
| Compound Name | 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene |
| PubChem CID | 162715137 |
| Molecular Formula | C14H28S2 |
| Molecular Weight | 260.51 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCSSC(C)(C)C |
| InChI | InChI=1S/C14H28S2/c1-12(2)8-7-9-13(3)10-11-15-16-14(4,5)6/h8,13H,7,9-11H2,1-6H3 |
| InChIKey | ZFFZHWYHBFLIBK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene?
The IUPAC name of 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene (CID 162715137) is 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene.
What is the SMILES notation for 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene?
The canonical SMILES for 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene is CC(C)=CCCC(C)CCSSC(C)(C)C.
What is the InChIKey of 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene?
The InChIKey is ZFFZHWYHBFLIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28S2/c1-12(2)8-7-9-13(3)10-11-15-16-14(4,5)6/h8,13H,7,9-11H2,1-6H3.
What are the key properties of 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene?
8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene has a molecular weight of 260.51 g/mol, XLogP of 5.94, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(tert-butyldisulfanyl)-2,6-dimethyloct-2-ene is sourced from PubChem (CID 162715137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).