C15H17Cl2FN2O2 — CID 162715378
(5R)-1-[(1S)-1-[3-chloro-2-(chloromethyl)-5-fluorophenyl]ethyl]-4,5-dimethylpiperazine-2,3-dione (PubChem CID 162715378) has the molecular formula C15H17Cl2FN2O2 and a molecular weight of 347.22 g/mol. Its IUPAC name is (5R)-1-[(1S)-1-[3-chloro-2-(chloromethyl)-5-fluorophenyl]ethyl]-4,5-dimethylpiperazine-2,3-dione.
| Compound Name | (5R)-1-[(1S)-1-[3-chloro-2-(chloromethyl)-5-fluorophenyl]ethyl]-4,5-dimethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 162715378 |
| Molecular Formula | C15H17Cl2FN2O2 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (5R)-1-[(1S)-1-[3-chloro-2-(chloromethyl)-5-fluorophenyl]ethyl]-4,5-dimethylpiperazine-2,3-dione |
| SMILES | C[C@@H]1CN([C@@H](C)c2cc(F)cc(Cl)c2CCl)C(=O)C(=O)N1C |
| InChI | InChI=1S/C15H17Cl2FN2O2/c1-8-7-20(15(22)14(21)19(8)3)9(2)11-4-10(18)5-13(17)12(11)6-16/h4-5,8-9H,6-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | MPLZQUSWJPCKST-BDAKNGLRSA-N |
| XLogP | 2.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|