C11H9N3 — CID 162715422
4,7,8-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,8,10,12-hexaene (PubChem CID 162715422) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,7,8-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,8,10,12-hexaene.
| Compound Name | 4,7,8-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,8,10,12-hexaene |
|---|---|
| PubChem CID | 162715422 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4,7,8-triazatricyclo[7.5.0.02,7]tetradeca-1(14),2,4,8,10,12-hexaene |
| SMILES | C1=CC=c2c(nn3c2=CN=CC3)C=C1 |
| InChI | InChI=1S/C11H9N3/c1-2-4-9-10(5-3-1)13-14-7-6-12-8-11(9)14/h1-6,8H,7H2 |
| InChIKey | IPZDGXPMBWLYPE-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |