C11H9BrClFN4O2S — CID 162715788
5-bromo-2-chloro-4-[3-fluoro-2-[(sulfinoamino)methyl]anilino]pyrimidine (PubChem CID 162715788) has the molecular formula C11H9BrClFN4O2S and a molecular weight of 395.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-[3-fluoro-2-[(sulfinoamino)methyl]anilino]pyrimidine.
| Compound Name | 5-bromo-2-chloro-4-[3-fluoro-2-[(sulfinoamino)methyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 162715788 |
| Molecular Formula | C11H9BrClFN4O2S |
| Molecular Weight | 395.64 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 5-bromo-2-chloro-4-[3-fluoro-2-[(sulfinoamino)methyl]anilino]pyrimidine |
| SMILES | O=S(O)NCc1c(F)cccc1Nc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C11H9BrClFN4O2S/c12-7-5-15-11(13)18-10(7)17-9-3-1-2-8(14)6(9)4-16-21(19)20/h1-3,5,16H,4H2,(H,19,20)(H,15,17,18) |
| InChIKey | NNAMDSIAEHRAGV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|