C3H5F2N5 — CID 162716552
1-(difluoromethyl)-1,2,4-triazole-3,5-diamine (PubChem CID 162716552) has the molecular formula C3H5F2N5 and a molecular weight of 149.10 g/mol. Its IUPAC name is 1-(difluoromethyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(difluoromethyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 162716552 |
| Molecular Formula | C3H5F2N5 |
| Molecular Weight | 149.10 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 1-(difluoromethyl)-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(N)n(C(F)F)n1 |
| InChI | InChI=1S/C3H5F2N5/c4-1(5)10-3(7)8-2(6)9-10/h1H,(H4,6,7,8,9) |
| InChIKey | YBFIQCIBCKSHLR-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.10 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |