C15H16ClN3O3 — CID 162717545
methyl (1S,2S,3R,4R)-3-[(5-carbamoyl-2-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 162717545) has the molecular formula C15H16ClN3O3 and a molecular weight of 321.76 g/mol. Its IUPAC name is methyl (1S,2S,3R,4R)-3-[(5-carbamoyl-2-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1S,2S,3R,4R)-3-[(5-carbamoyl-2-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 162717545 |
| Molecular Formula | C15H16ClN3O3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | methyl (1S,2S,3R,4R)-3-[(5-carbamoyl-2-chloro-4-pyridinyl)amino]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](Nc2cc(Cl)ncc2C(N)=O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H16ClN3O3/c1-22-15(21)12-7-2-3-8(4-7)13(12)19-10-5-11(16)18-6-9(10)14(17)20/h2-3,5-8,12-13H,4H2,1H3,(H2,17,20)(H,18,19)/t7-,8+,12+,13-/m1/s1 |
| InChIKey | FHYDVUWIYZJIRF-BOOASOPXSA-N |
| XLogP | 1.61 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|