About 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine
2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine (PubChem CID 162717711) has the molecular formula C14H6F2N4S2
and a molecular weight of 332.36 g/mol. Its IUPAC name is 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine.
Molecular Properties
| Compound Name | 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine |
| PubChem CID | 162717711 |
| Molecular Formula | C14H6F2N4S2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine |
| SMILES | Fc1nc2c(-c3cccs3)nnc(-c3cccs3)c2nc1F |
| InChI | InChI=1S/C14H6F2N4S2/c15-13-14(16)18-12-10(8-4-2-6-22-8)20-19-9(11(12)17-13)7-3-1-5-21-7/h1-6H |
| InChIKey | AOKAZGILIMOBGL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine?
The IUPAC name of 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine (CID 162717711) is 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine.
What is the SMILES notation for 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine?
The canonical SMILES for 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine is Fc1nc2c(-c3cccs3)nnc(-c3cccs3)c2nc1F.
What is the InChIKey of 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine?
The InChIKey is AOKAZGILIMOBGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6F2N4S2/c15-13-14(16)18-12-10(8-4-2-6-22-8)20-19-9(11(12)17-13)7-3-1-5-21-7/h1-6H.
What are the key properties of 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine?
2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine has a molecular weight of 332.36 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-5,8-dithiophen-2-ylpyrazino[2,3-d]pyridazine is sourced from PubChem (CID 162717711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).