C30H44N4O2 — CID 162717936
1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1,3-dicarboxamide (PubChem CID 162717936) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 162717936 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 1-N,3-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)naphthalene-1,3-dicarboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cc(C(=O)NC3CC(C)(C)NC(C)(C)C3)c3ccccc3c2)CC(C)(C)N1 |
| InChI | InChI=1S/C30H44N4O2/c1-27(2)15-21(16-28(3,4)33-27)31-25(35)20-13-19-11-9-10-12-23(19)24(14-20)26(36)32-22-17-29(5,6)34-30(7,8)18-22/h9-14,21-22,33-34H,15-18H2,1-8H3,(H,31,35)(H,32,36) |
| InChIKey | ZMLQHPMTYMUNDA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |