About tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate
tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate (PubChem CID 162718211) has the molecular formula C27H32N4O2
and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate |
| PubChem CID | 162718211 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2cnc(-c3ccccc3)c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C27H32N4O2/c1-27(2,3)33-26(32)29-18-20-14-16-31(17-15-20)23-19-28-24(21-10-6-4-7-11-21)25(30-23)22-12-8-5-9-13-22/h4-13,19-20H,14-18H2,1-3H3,(H,29,32) |
| InChIKey | HKLNQUBMPQZRDO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate?
The IUPAC name of tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate (CID 162718211) is tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate.
What is the SMILES notation for tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate?
The canonical SMILES for tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate is CC(C)(C)OC(=O)NCC1CCN(c2cnc(-c3ccccc3)c(-c3ccccc3)n2)CC1.
What is the InChIKey of tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate?
The InChIKey is HKLNQUBMPQZRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H32N4O2/c1-27(2,3)33-26(32)29-18-20-14-16-31(17-15-20)23-19-28-24(21-10-6-4-7-11-21)25(30-23)22-12-8-5-9-13-22/h4-13,19-20H,14-18H2,1-3H3,(H,29,32).
What are the key properties of tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate?
tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate has a molecular weight of 444.58 g/mol, XLogP of 5.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]methyl]carbamate is sourced from PubChem (CID 162718211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).