About phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate
phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate (PubChem CID 162718220) has the molecular formula C28H26N4O2
and a molecular weight of 450.54 g/mol. Its IUPAC name is phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate |
| PubChem CID | 162718220 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate |
| SMILES | O=C(NC1CCN(c2cnc(-c3ccccc3)c(-c3ccccc3)n2)CC1)Oc1ccccc1 |
| InChI | InChI=1S/C28H26N4O2/c33-28(34-24-14-8-3-9-15-24)30-23-16-18-32(19-17-23)25-20-29-26(21-10-4-1-5-11-21)27(31-25)22-12-6-2-7-13-22/h1-15,20,23H,16-19H2,(H,30,33) |
| InChIKey | CDHNHSIZLJAZBV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate?
The IUPAC name of phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate (CID 162718220) is phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate.
What is the SMILES notation for phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate?
The canonical SMILES for phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate is O=C(NC1CCN(c2cnc(-c3ccccc3)c(-c3ccccc3)n2)CC1)Oc1ccccc1.
What is the InChIKey of phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate?
The InChIKey is CDHNHSIZLJAZBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H26N4O2/c33-28(34-24-14-8-3-9-15-24)30-23-16-18-32(19-17-23)25-20-29-26(21-10-4-1-5-11-21)27(31-25)22-12-6-2-7-13-22/h1-15,20,23H,16-19H2,(H,30,33).
What are the key properties of phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate?
phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate has a molecular weight of 450.54 g/mol, XLogP of 5.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[1-(5,6-diphenylpyrazin-2-yl)piperidin-4-yl]carbamate is sourced from PubChem (CID 162718220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).