C15H16N2O4 — CID 162718760
ethyl 3-oxo-3-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]propanoate (PubChem CID 162718760) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is ethyl 3-oxo-3-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]propanoate.
| Compound Name | ethyl 3-oxo-3-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 162718760 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | ethyl 3-oxo-3-[4-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]propanoate |
| SMILES | CCOC(=O)CC(=O)c1ccc(C2=NNC(=O)CC2)cc1 |
| InChI | InChI=1S/C15H16N2O4/c1-2-21-15(20)9-13(18)11-5-3-10(4-6-11)12-7-8-14(19)17-16-12/h3-6H,2,7-9H2,1H3,(H,17,19) |
| InChIKey | GBQWROVNJKRCDD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|