C31H42N8O4S2 — CID 162719441
N-[2-[[2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-(propan-2-ylamino)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl]-N-methoxymethanesulfonamide (PubChem CID 162719441) has the molecular formula C31H42N8O4S2 and a molecular weight of 654.86 g/mol. Its IUPAC name is N-[2-[[2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-(propan-2-ylamino)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl]-N-methoxymethanesulfonamide.
| Compound Name | N-[2-[[2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-(propan-2-ylamino)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl]-N-methoxymethanesulfonamide |
|---|---|
| PubChem CID | 162719441 |
| Molecular Formula | C31H42N8O4S2 |
| Molecular Weight | 654.86 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | N-[2-[[2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxy-5-(propan-2-ylamino)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]phenyl]-N-methoxymethanesulfonamide |
| SMILES | COc1cc(N2CCC(N(C)C)CC2)c(NC(C)C)cc1Nc1nc(Nc2ccccc2N(OC)S(C)(=O)=O)c2sccc2n1 |
| InChI | InChI=1S/C31H42N8O4S2/c1-20(2)32-24-18-25(28(42-5)19-27(24)38-15-12-21(13-16-38)37(3)4)35-31-34-23-14-17-44-29(23)30(36-31)33-22-10-8-9-11-26(22)39(43-6)45(7,40)41/h8-11,14,17-21,32H,12-13,15-16H2,1-7H3,(H2,33,34,35,36) |
| InChIKey | ZHTYVRHEHQPWGW-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.86 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|