C34H38FN7O2 — CID 162719756
2-[(2S)-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile (PubChem CID 162719756) has the molecular formula C34H38FN7O2 and a molecular weight of 595.72 g/mol. Its IUPAC name is 2-[(2S)-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile.
| Compound Name | 2-[(2S)-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 162719756 |
| Molecular Formula | C34H38FN7O2 |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | 2-[(2S)-4-[8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-7-(5,6,7,8-tetrahydronaphthalen-1-yl)pyrido[4,3-d]pyrimidin-4-yl]-1-prop-2-enoylpiperazin-2-yl]acetonitrile |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5c4CCCC5)ncc23)C[C@@H]1CC#N |
| InChI | InChI=1S/C34H38FN7O2/c1-2-28(43)42-19-18-40(21-24(42)12-15-36)32-27-20-37-30(26-11-5-9-23-8-3-4-10-25(23)26)29(35)31(27)38-33(39-32)44-22-34-13-6-16-41(34)17-7-14-34/h2,5,9,11,20,24H,1,3-4,6-8,10,12-14,16-19,21-22H2/t24-/m0/s1 |
| InChIKey | ILSZPBVJHYHUAQ-DEOSSOPVSA-N |
| XLogP | 4.83 |
| TPSA | 98.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|