About 3-cyclohexyl-3,4-dihydropyrrol-2-one
3-cyclohexyl-3,4-dihydropyrrol-2-one (PubChem CID 162720019) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-cyclohexyl-3,4-dihydropyrrol-2-one.
Molecular Properties
| Compound Name | 3-cyclohexyl-3,4-dihydropyrrol-2-one |
| PubChem CID | 162720019 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-cyclohexyl-3,4-dihydropyrrol-2-one |
| SMILES | O=C1N=CCC1C1CCCCC1 |
| InChI | InChI=1S/C10H15NO/c12-10-9(6-7-11-10)8-4-2-1-3-5-8/h7-9H,1-6H2 |
| InChIKey | WREWQHWYPUZKOJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-3,4-dihydropyrrol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-3,4-dihydropyrrol-2-one?
The IUPAC name of 3-cyclohexyl-3,4-dihydropyrrol-2-one (CID 162720019) is 3-cyclohexyl-3,4-dihydropyrrol-2-one.
What is the SMILES notation for 3-cyclohexyl-3,4-dihydropyrrol-2-one?
The canonical SMILES for 3-cyclohexyl-3,4-dihydropyrrol-2-one is O=C1N=CCC1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-3,4-dihydropyrrol-2-one?
The InChIKey is WREWQHWYPUZKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-10-9(6-7-11-10)8-4-2-1-3-5-8/h7-9H,1-6H2.
What are the key properties of 3-cyclohexyl-3,4-dihydropyrrol-2-one?
3-cyclohexyl-3,4-dihydropyrrol-2-one has a molecular weight of 165.24 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-3,4-dihydropyrrol-2-one is sourced from PubChem (CID 162720019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).