About 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one
5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 162720131) has the molecular formula C18H12Cl2FN5O
and a molecular weight of 404.23 g/mol. Its IUPAC name is 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 162720131 |
| Molecular Formula | C18H12Cl2FN5O |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | O=c1c2cnn(-c3ccc(Cl)cc3)c2nc(-c2ccc(F)nc2)n1CCCl |
| InChI | InChI=1S/C18H12Cl2FN5O/c19-7-8-25-16(11-1-6-15(21)22-9-11)24-17-14(18(25)27)10-23-26(17)13-4-2-12(20)3-5-13/h1-6,9-10H,7-8H2 |
| InChIKey | MMZSDIYMPQALFW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one (CID 162720131) is 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one is O=c1c2cnn(-c3ccc(Cl)cc3)c2nc(-c2ccc(F)nc2)n1CCCl.
What is the InChIKey of 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is MMZSDIYMPQALFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2FN5O/c19-7-8-25-16(11-1-6-15(21)22-9-11)24-17-14(18(25)27)10-23-26(17)13-4-2-12(20)3-5-13/h1-6,9-10H,7-8H2.
What are the key properties of 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one?
5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 404.23 g/mol, XLogP of 3.68, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chloroethyl)-1-(4-chlorophenyl)-6-(6-fluoro-3-pyridinyl)pyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 162720131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).