C19H16ClN5O2 — CID 162720138
5-(2-chloroethyl)-6-(2-methoxy-3-pyridinyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 162720138) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is 5-(2-chloroethyl)-6-(2-methoxy-3-pyridinyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-(2-chloroethyl)-6-(2-methoxy-3-pyridinyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 162720138 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-(2-chloroethyl)-6-(2-methoxy-3-pyridinyl)-1-phenylpyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | COc1ncccc1-c1nc2c(cnn2-c2ccccc2)c(=O)n1CCCl |
| InChI | InChI=1S/C19H16ClN5O2/c1-27-18-14(8-5-10-21-18)16-23-17-15(19(26)24(16)11-9-20)12-22-25(17)13-6-3-2-4-7-13/h2-8,10,12H,9,11H2,1H3 |
| InChIKey | FXMVOZCPVVBXAU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|