About 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole
4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole (PubChem CID 162720511) has the molecular formula C26H38O2S2
and a molecular weight of 446.72 g/mol. Its IUPAC name is 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole.
Molecular Properties
| Compound Name | 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole |
| PubChem CID | 162720511 |
| Molecular Formula | C26H38O2S2 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole |
| SMILES | CCCCCC(CC)Oc1c(OC(CC)CCCCC)c2ccsc2c2sccc12 |
| InChI | InChI=1S/C26H38O2S2/c1-5-9-11-13-19(7-3)27-23-21-15-17-29-25(21)26-22(16-18-30-26)24(23)28-20(8-4)14-12-10-6-2/h15-20H,5-14H2,1-4H3 |
| InChIKey | HJEQDHLNEGMGIA-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole?
The IUPAC name of 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole (CID 162720511) is 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole.
What is the SMILES notation for 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole?
The canonical SMILES for 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole is CCCCCC(CC)Oc1c(OC(CC)CCCCC)c2ccsc2c2sccc12.
What is the InChIKey of 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole?
The InChIKey is HJEQDHLNEGMGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H38O2S2/c1-5-9-11-13-19(7-3)27-23-21-15-17-29-25(21)26-22(16-18-30-26)24(23)28-20(8-4)14-12-10-6-2/h15-20H,5-14H2,1-4H3.
What are the key properties of 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole?
4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole has a molecular weight of 446.72 g/mol, XLogP of 9.59, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-di(octan-3-yloxy)thieno[3,2-g][1]benzothiole is sourced from PubChem (CID 162720511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).