About 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine
2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine (PubChem CID 162720673) has the molecular formula C21H17N5
and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine.
Molecular Properties
| Compound Name | 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine |
| PubChem CID | 162720673 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine |
| SMILES | Nc1ccc(-c2nc3c4cc(N)ccc4c4ccc(N)cc4c3[nH]2)cc1 |
| InChI | InChI=1S/C21H17N5/c22-12-3-1-11(2-4-12)21-25-19-17-9-13(23)5-7-15(17)16-8-6-14(24)10-18(16)20(19)26-21/h1-10H,22-24H2,(H,25,26) |
| InChIKey | NIIXEVMXQFOOLP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine?
The IUPAC name of 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine (CID 162720673) is 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine.
What is the SMILES notation for 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine?
The canonical SMILES for 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine is Nc1ccc(-c2nc3c4cc(N)ccc4c4ccc(N)cc4c3[nH]2)cc1.
What is the InChIKey of 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine?
The InChIKey is NIIXEVMXQFOOLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5/c22-12-3-1-11(2-4-12)21-25-19-17-9-13(23)5-7-15(17)16-8-6-14(24)10-18(16)20(19)26-21/h1-10H,22-24H2,(H,25,26).
What are the key properties of 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine?
2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine has a molecular weight of 339.40 g/mol, XLogP of 4.28, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-aminophenyl)-1H-phenanthro[9,10-d]imidazole-5,10-diamine is sourced from PubChem (CID 162720673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).