C14H31N2+ — CID 162721105
ethyl-dimethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)azanium (PubChem CID 162721105) has the molecular formula C14H31N2+ and a molecular weight of 227.42 g/mol. Its IUPAC name is ethyl-dimethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)azanium.
| Compound Name | ethyl-dimethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)azanium |
|---|---|
| PubChem CID | 162721105 |
| Molecular Formula | C14H31N2+ |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.25 |
| IUPAC Name | ethyl-dimethyl-(1,2,2,6,6-pentamethylpiperidin-4-yl)azanium |
| SMILES | CC[N+](C)(C)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C14H31N2/c1-9-16(7,8)12-10-13(2,3)15(6)14(4,5)11-12/h12H,9-11H2,1-8H3/q+1 |
| InChIKey | QMWZIEZIKHDHGH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|