C14H15Cl2F2N3O2 — CID 162721683
N-[[(2R)-1-(3,6-dichloropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]acetamide (PubChem CID 162721683) has the molecular formula C14H15Cl2F2N3O2 and a molecular weight of 366.20 g/mol. Its IUPAC name is N-[[(2R)-1-(3,6-dichloropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R)-1-(3,6-dichloropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 162721683 |
| Molecular Formula | C14H15Cl2F2N3O2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[[(2R)-1-(3,6-dichloropyridine-2-carbonyl)-5,5-difluoropiperidin-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1CCC(F)(F)CN1C(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H15Cl2F2N3O2/c1-8(22)19-6-9-4-5-14(17,18)7-21(9)13(23)12-10(15)2-3-11(16)20-12/h2-3,9H,4-7H2,1H3,(H,19,22)/t9-/m1/s1 |
| InChIKey | CUVNOTVHGGEWOB-SECBINFHSA-N |
| XLogP | 2.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|