C6H10F2N2 — CID 162721845
(Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine (PubChem CID 162721845) has the molecular formula C6H10F2N2 and a molecular weight of 148.16 g/mol. Its IUPAC name is (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine.
| Compound Name | (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine |
|---|---|
| PubChem CID | 162721845 |
| Molecular Formula | C6H10F2N2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | (Z,4E)-4-(difluoromethylimino)pent-2-en-2-amine |
| SMILES | C/C(N)=C/C(C)=N/C(F)F |
| InChI | InChI=1S/C6H10F2N2/c1-4(9)3-5(2)10-6(7)8/h3,6H,9H2,1-2H3/b4-3-,10-5+ |
| InChIKey | QGZGNOXOCLEKEK-DXWLQBKVSA-N |
| XLogP | 1.53 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|