C19H15F2N5O — CID 162721923
3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]imidazol-4-yl]aniline (PubChem CID 162721923) has the molecular formula C19H15F2N5O and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]imidazol-4-yl]aniline.
| Compound Name | 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]imidazol-4-yl]aniline |
|---|---|
| PubChem CID | 162721923 |
| Molecular Formula | C19H15F2N5O |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]phenyl]methyl]imidazol-4-yl]aniline |
| SMILES | Nc1cccc(-c2cn(Cc3ccc(-c4nnc(C(F)F)o4)cc3)cn2)c1 |
| InChI | InChI=1S/C19H15F2N5O/c20-17(21)19-25-24-18(27-19)13-6-4-12(5-7-13)9-26-10-16(23-11-26)14-2-1-3-15(22)8-14/h1-8,10-11,17H,9,22H2 |
| InChIKey | VRIJRVXCJYVFII-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|