C18H12F4N6O — CID 162721958
3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]triazol-4-yl]aniline (PubChem CID 162721958) has the molecular formula C18H12F4N6O and a molecular weight of 404.33 g/mol. Its IUPAC name is 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]triazol-4-yl]aniline.
| Compound Name | 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]triazol-4-yl]aniline |
|---|---|
| PubChem CID | 162721958 |
| Molecular Formula | C18H12F4N6O |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-[1-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2,6-difluorophenyl]methyl]triazol-4-yl]aniline |
| SMILES | Nc1cccc(-c2cn(Cc3c(F)cc(-c4nnc(C(F)F)o4)cc3F)nn2)c1 |
| InChI | InChI=1S/C18H12F4N6O/c19-13-5-10(17-25-26-18(29-17)16(21)22)6-14(20)12(13)7-28-8-15(24-27-28)9-2-1-3-11(23)4-9/h1-6,8,16H,7,23H2 |
| InChIKey | ASNYLLYBBCLGBZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|