C23H23F3N7OP — CID 162721994
3,3-difluoroprop-1-en-2-yl 4-[[[(E)-1-(2-aminoquinazolin-6-yl)ethylideneamino]-(methylideneamino)amino]methyl]-5-fluoro-N-methyl-2-phosphanylbenzenecarboximidate (PubChem CID 162721994) has the molecular formula C23H23F3N7OP and a molecular weight of 501.45 g/mol. Its IUPAC name is 3,3-difluoroprop-1-en-2-yl 4-[[[(E)-1-(2-aminoquinazolin-6-yl)ethylideneamino]-(methylideneamino)amino]methyl]-5-fluoro-N-methyl-2-phosphanylbenzenecarboximidate.
| Compound Name | 3,3-difluoroprop-1-en-2-yl 4-[[[(E)-1-(2-aminoquinazolin-6-yl)ethylideneamino]-(methylideneamino)amino]methyl]-5-fluoro-N-methyl-2-phosphanylbenzenecarboximidate |
|---|---|
| PubChem CID | 162721994 |
| Molecular Formula | C23H23F3N7OP |
| Molecular Weight | 501.45 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 3,3-difluoroprop-1-en-2-yl 4-[[[(E)-1-(2-aminoquinazolin-6-yl)ethylideneamino]-(methylideneamino)amino]methyl]-5-fluoro-N-methyl-2-phosphanylbenzenecarboximidate |
| SMILES | C=NN(Cc1cc(P)c(/C(=N/C)OC(=C)C(F)F)cc1F)/N=C(\C)c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C23H23F3N7OP/c1-12(14-5-6-19-15(7-14)10-30-23(27)31-19)32-33(29-4)11-16-8-20(35)17(9-18(16)24)22(28-3)34-13(2)21(25)26/h5-10,21H,2,4,11,35H2,1,3H3,(H2,27,30,31)/b28-22-,32-12+ |
| InChIKey | KAGMYAYHNGQJSM-QJOIMNBISA-N |
| XLogP | 3.87 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|