C21H16F3N7O2 — CID 162722007
N-[4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 162722007) has the molecular formula C21H16F3N7O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is N-[4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | N-[4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 162722007 |
| Molecular Formula | C21H16F3N7O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[4-[5-[[4-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-fluorophenyl]methyl]-1,2,4-oxadiazol-3-yl]phenyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | Fc1cc(-c2nnc(C(F)F)o2)ccc1Cc1nc(-c2ccc(NC3=NCCN3)cc2)no1 |
| InChI | InChI=1S/C21H16F3N7O2/c22-15-9-13(19-29-30-20(32-19)17(23)24)2-1-12(15)10-16-28-18(31-33-16)11-3-5-14(6-4-11)27-21-25-7-8-26-21/h1-6,9,17H,7-8,10H2,(H2,25,26,27) |
| InChIKey | BCXKPRDWWIGHMV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |